C28H38N2O4 — CID 14899540
methyl 2-[(1-methoxy-2,4-dimethyl-1-oxo-4-phenylpentan-2-yl)diazenyl]-2,4-dimethyl-4-phenylpentanoate (PubChem CID 14899540) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is methyl 2-[(1-methoxy-2,4-dimethyl-1-oxo-4-phenylpentan-2-yl)diazenyl]-2,4-dimethyl-4-phenylpentanoate.
| Compound Name | methyl 2-[(1-methoxy-2,4-dimethyl-1-oxo-4-phenylpentan-2-yl)diazenyl]-2,4-dimethyl-4-phenylpentanoate |
|---|---|
| PubChem CID | 14899540 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | methyl 2-[(1-methoxy-2,4-dimethyl-1-oxo-4-phenylpentan-2-yl)diazenyl]-2,4-dimethyl-4-phenylpentanoate |
| SMILES | COC(=O)C(C)(CC(C)(C)c1ccccc1)/N=N/C(C)(CC(C)(C)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C28H38N2O4/c1-25(2,21-15-11-9-12-16-21)19-27(5,23(31)33-7)29-30-28(6,24(32)34-8)20-26(3,4)22-17-13-10-14-18-22/h9-18H,19-20H2,1-8H3/b30-29+ |
| InChIKey | YWCUYTSQKSMIGC-QVIHXGFCSA-N |
| XLogP | 6.04 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|