About [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate
[[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate (PubChem CID 2799478) has the molecular formula C14H13ClN2O5S2
and a molecular weight of 388.85 g/mol. Its IUPAC name is [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate |
| PubChem CID | 2799478 |
| Molecular Formula | C14H13ClN2O5S2 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate |
| SMILES | NC(CS(=O)(=O)c1ccccc1)=NOS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H13ClN2O5S2/c15-11-6-8-13(9-7-11)24(20,21)22-17-14(16)10-23(18,19)12-4-2-1-3-5-12/h1-9H,10H2,(H2,16,17) |
| InChIKey | IVDWDVDOLVADGX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate?
The IUPAC name of [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate (CID 2799478) is [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate.
What is the SMILES notation for [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate?
The canonical SMILES for [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate is NC(CS(=O)(=O)c1ccccc1)=NOS(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate?
The InChIKey is IVDWDVDOLVADGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN2O5S2/c15-11-6-8-13(9-7-11)24(20,21)22-17-14(16)10-23(18,19)12-4-2-1-3-5-12/h1-9H,10H2,(H2,16,17).
What are the key properties of [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate?
[[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate has a molecular weight of 388.85 g/mol, XLogP of 1.79, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 4-chlorobenzenesulfonate is sourced from PubChem (CID 2799478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).