About [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate
[[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate (PubChem CID 4526677) has the molecular formula C16H16N2O5S
and a molecular weight of 348.38 g/mol. Its IUPAC name is [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate.
Molecular Properties
| Compound Name | [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate |
| PubChem CID | 4526677 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)ON=C(N)CS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O5S/c1-22-13-7-5-6-12(10-13)16(19)23-18-15(17)11-24(20,21)14-8-3-2-4-9-14/h2-10H,11H2,1H3,(H2,17,18) |
| InChIKey | WWEKSHDKMHRIPB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate?
The IUPAC name of [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate (CID 4526677) is [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate.
What is the SMILES notation for [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate?
The canonical SMILES for [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate is COc1cccc(C(=O)ON=C(N)CS(=O)(=O)c2ccccc2)c1.
What is the InChIKey of [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate?
The InChIKey is WWEKSHDKMHRIPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O5S/c1-22-13-7-5-6-12(10-13)16(19)23-18-15(17)11-24(20,21)14-8-3-2-4-9-14/h2-10H,11H2,1H3,(H2,17,18).
What are the key properties of [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate?
[[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate has a molecular weight of 348.38 g/mol, XLogP of 1.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-amino-2-(benzenesulfonyl)ethylidene]amino] 3-methoxybenzoate is sourced from PubChem (CID 4526677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).