About [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate
[[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate (PubChem CID 2765908) has the molecular formula C17H17ClN2O5S2
and a molecular weight of 428.92 g/mol. Its IUPAC name is [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate |
| PubChem CID | 2765908 |
| Molecular Formula | C17H17ClN2O5S2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate |
| SMILES | O=S(=O)(ON=C1CCN(S(=O)(=O)c2ccccc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O5S2/c18-14-6-8-17(9-7-14)27(23,24)25-19-15-10-12-20(13-11-15)26(21,22)16-4-2-1-3-5-16/h1-9H,10-13H2 |
| InChIKey | GRCRANCOSJRHGH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate?
The IUPAC name of [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate (CID 2765908) is [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate.
What is the SMILES notation for [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate?
The canonical SMILES for [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate is O=S(=O)(ON=C1CCN(S(=O)(=O)c2ccccc2)CC1)c1ccc(Cl)cc1.
What is the InChIKey of [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate?
The InChIKey is GRCRANCOSJRHGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN2O5S2/c18-14-6-8-17(9-7-14)27(23,24)25-19-15-10-12-20(13-11-15)26(21,22)16-4-2-1-3-5-16/h1-9H,10-13H2.
What are the key properties of [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate?
[[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate has a molecular weight of 428.92 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-(benzenesulfonyl)piperidin-4-ylidene]amino] 4-chlorobenzenesulfonate is sourced from PubChem (CID 2765908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).