C17H12F2I2O8S2 — CID 177115370
2-[4-(4-ethenylphenyl)sulfonyloxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 177115370) has the molecular formula C17H12F2I2O8S2 and a molecular weight of 700.21 g/mol. Its IUPAC name is 2-[4-(4-ethenylphenyl)sulfonyloxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[4-(4-ethenylphenyl)sulfonyloxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 177115370 |
| Molecular Formula | C17H12F2I2O8S2 |
| Molecular Weight | 700.21 g/mol |
| Exact Mass | 699.80 |
| IUPAC Name | 2-[4-(4-ethenylphenyl)sulfonyloxy-3,5-diiodobenzoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | C=Cc1ccc(S(=O)(=O)Oc2c(I)cc(C(=O)OCC(F)(F)S(=O)(=O)O)cc2I)cc1 |
| InChI | InChI=1S/C17H12F2I2O8S2/c1-2-10-3-5-12(6-4-10)30(23,24)29-15-13(20)7-11(8-14(15)21)16(22)28-9-17(18,19)31(25,26)27/h2-8H,1,9H2,(H,25,26,27) |
| InChIKey | VEGDZNKFEDNBRP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|