About decyl 2-ethenylbenzoate
decyl 2-ethenylbenzoate (PubChem CID 139672721) has the molecular formula C19H28O2
and a molecular weight of 288.43 g/mol. Its IUPAC name is decyl 2-ethenylbenzoate.
Molecular Properties
| Compound Name | decyl 2-ethenylbenzoate |
| PubChem CID | 139672721 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | decyl 2-ethenylbenzoate |
| SMILES | C=Cc1ccccc1C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C19H28O2/c1-3-5-6-7-8-9-10-13-16-21-19(20)18-15-12-11-14-17(18)4-2/h4,11-12,14-15H,2-3,5-10,13,16H2,1H3 |
| InChIKey | BPFVWIVYHJFMHF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl 2-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl 2-ethenylbenzoate?
The IUPAC name of decyl 2-ethenylbenzoate (CID 139672721) is decyl 2-ethenylbenzoate.
What is the SMILES notation for decyl 2-ethenylbenzoate?
The canonical SMILES for decyl 2-ethenylbenzoate is C=Cc1ccccc1C(=O)OCCCCCCCCCC.
What is the InChIKey of decyl 2-ethenylbenzoate?
The InChIKey is BPFVWIVYHJFMHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O2/c1-3-5-6-7-8-9-10-13-16-21-19(20)18-15-12-11-14-17(18)4-2/h4,11-12,14-15H,2-3,5-10,13,16H2,1H3.
What are the key properties of decyl 2-ethenylbenzoate?
decyl 2-ethenylbenzoate has a molecular weight of 288.43 g/mol, XLogP of 5.63, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decyl 2-ethenylbenzoate is sourced from PubChem (CID 139672721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).