C16H13F3O6S — CID 150195557
2-[1-ethyl-3-methyl-4-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-oxoacetic acid (PubChem CID 150195557) has the molecular formula C16H13F3O6S and a molecular weight of 390.34 g/mol. Its IUPAC name is 2-[1-ethyl-3-methyl-4-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-oxoacetic acid.
| Compound Name | 2-[1-ethyl-3-methyl-4-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 150195557 |
| Molecular Formula | C16H13F3O6S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 2-[1-ethyl-3-methyl-4-(trifluoromethylsulfonyloxy)naphthalen-2-yl]-2-oxoacetic acid |
| SMILES | CCc1c(C(=O)C(=O)O)c(C)c(OS(=O)(=O)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C16H13F3O6S/c1-3-9-10-6-4-5-7-11(10)14(25-26(23,24)16(17,18)19)8(2)12(9)13(20)15(21)22/h4-7H,3H2,1-2H3,(H,21,22) |
| InChIKey | FOJIHJWJJTXNEB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|