C15H19N3O5S — CID 3220629
N'-(4-morpholin-4-ylsulfonylphenyl)-N-prop-2-enyloxamide (PubChem CID 3220629) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is N'-(4-morpholin-4-ylsulfonylphenyl)-N-prop-2-enyloxamide.
| Compound Name | N'-(4-morpholin-4-ylsulfonylphenyl)-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 3220629 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N'-(4-morpholin-4-ylsulfonylphenyl)-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H19N3O5S/c1-2-7-16-14(19)15(20)17-12-3-5-13(6-4-12)24(21,22)18-8-10-23-11-9-18/h2-6H,1,7-11H2,(H,16,19)(H,17,20) |
| InChIKey | CIFBZSLFKJXUFZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|