C25H29N7O3S — CID 71207903
2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6-propylpyrimido[5,4-c][2,1]benzothiazine-8-carboxamide (PubChem CID 71207903) has the molecular formula C25H29N7O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6-propylpyrimido[5,4-c][2,1]benzothiazine-8-carboxamide.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6-propylpyrimido[5,4-c][2,1]benzothiazine-8-carboxamide |
|---|---|
| PubChem CID | 71207903 |
| Molecular Formula | C25H29N7O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6-propylpyrimido[5,4-c][2,1]benzothiazine-8-carboxamide |
| SMILES | CCCN1c2cc(C(N)=O)ccc2-c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2S1(=O)=O |
| InChI | InChI=1S/C25H29N7O3S/c1-3-10-32-21-15-17(24(26)33)4-9-20(21)23-22(36(32,34)35)16-27-25(29-23)28-18-5-7-19(8-6-18)31-13-11-30(2)12-14-31/h4-9,15-16H,3,10-14H2,1-2H3,(H2,26,33)(H,27,28,29) |
| InChIKey | VZKLXGNZEZBXCG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|