C28H35N7O2S — CID 90146210
N-(2-methoxyethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-propylpyrimido[5,4-c][2,1]benzothiazine-8-carboxamide (PubChem CID 90146210) has the molecular formula C28H35N7O2S and a molecular weight of 533.70 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-propylpyrimido[5,4-c][2,1]benzothiazine-8-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-propylpyrimido[5,4-c][2,1]benzothiazine-8-carboxamide |
|---|---|
| PubChem CID | 90146210 |
| Molecular Formula | C28H35N7O2S |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-propylpyrimido[5,4-c][2,1]benzothiazine-8-carboxamide |
| SMILES | CCCN1Sc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2-c2ccc(C(=O)NCCOC)cc21 |
| InChI | InChI=1S/C28H35N7O2S/c1-4-12-35-24-18-20(27(36)29-11-17-37-3)5-10-23(24)26-25(38-35)19-30-28(32-26)31-21-6-8-22(9-7-21)34-15-13-33(2)14-16-34/h5-10,18-19H,4,11-17H2,1-3H3,(H,29,36)(H,30,31,32) |
| InChIKey | RESHCGBFMPFRMS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|