C27H34N6O3S — CID 71208205
2-[2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6-propylpyrimido[5,4-c][2,1]benzothiazin-8-yl]propan-2-ol (PubChem CID 71208205) has the molecular formula C27H34N6O3S and a molecular weight of 522.68 g/mol. Its IUPAC name is 2-[2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6-propylpyrimido[5,4-c][2,1]benzothiazin-8-yl]propan-2-ol.
| Compound Name | 2-[2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6-propylpyrimido[5,4-c][2,1]benzothiazin-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 71208205 |
| Molecular Formula | C27H34N6O3S |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 2-[2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6-propylpyrimido[5,4-c][2,1]benzothiazin-8-yl]propan-2-ol |
| SMILES | CCCN1c2cc(C(C)(C)O)ccc2-c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2S1(=O)=O |
| InChI | InChI=1S/C27H34N6O3S/c1-5-12-33-23-17-19(27(2,3)34)6-11-22(23)25-24(37(33,35)36)18-28-26(30-25)29-20-7-9-21(10-8-20)32-15-13-31(4)14-16-32/h6-11,17-18,34H,5,12-16H2,1-4H3,(H,28,29,30) |
| InChIKey | OVQGQXWOLUFPCZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|