C27H33N7O — CID 155147142
2-[6-[6-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]-2-pyridinyl]propan-2-ol (PubChem CID 155147142) has the molecular formula C27H33N7O and a molecular weight of 471.61 g/mol. Its IUPAC name is 2-[6-[6-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-[6-[6-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 155147142 |
| Molecular Formula | C27H33N7O |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 2-[6-[6-ethyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]-2-pyridinyl]propan-2-ol |
| SMILES | CCc1cc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2n1-c1cccc(C(C)(C)O)n1 |
| InChI | InChI=1S/C27H33N7O/c1-5-21-17-19-18-28-26(29-20-9-11-22(12-10-20)33-15-13-32(4)14-16-33)31-25(19)34(21)24-8-6-7-23(30-24)27(2,3)35/h6-12,17-18,35H,5,13-16H2,1-4H3,(H,28,29,31) |
| InChIKey | RAMYDSSWYFKVKC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|