C28H34N8O2 — CID 123365748
8-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-[4-(4-methylpiperazin-1-yl)anilino]-6-prop-2-enyl-7H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 123365748) has the molecular formula C28H34N8O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is 8-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-[4-(4-methylpiperazin-1-yl)anilino]-6-prop-2-enyl-7H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 8-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-[4-(4-methylpiperazin-1-yl)anilino]-6-prop-2-enyl-7H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 123365748 |
| Molecular Formula | C28H34N8O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 8-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-[4-(4-methylpiperazin-1-yl)anilino]-6-prop-2-enyl-7H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | C=CCN1CN(c2cccc(C(C)(C)O)n2)c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2C1=O |
| InChI | InChI=1S/C28H34N8O2/c1-5-13-35-19-36(24-8-6-7-23(31-24)28(2,3)38)25-22(26(35)37)18-29-27(32-25)30-20-9-11-21(12-10-20)34-16-14-33(4)15-17-34/h5-12,18,38H,1,13-17,19H2,2-4H3,(H,29,30,32) |
| InChIKey | LKTSDNJDIGLTPS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|