C23H24N6O4S — CID 71208011
methyl 2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6H-pyrimido[5,4-c][2,1]benzothiazine-8-carboxylate (PubChem CID 71208011) has the molecular formula C23H24N6O4S and a molecular weight of 480.55 g/mol. Its IUPAC name is methyl 2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6H-pyrimido[5,4-c][2,1]benzothiazine-8-carboxylate.
| Compound Name | methyl 2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6H-pyrimido[5,4-c][2,1]benzothiazine-8-carboxylate |
|---|---|
| PubChem CID | 71208011 |
| Molecular Formula | C23H24N6O4S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | methyl 2-[4-(4-methylpiperazin-1-yl)anilino]-5,5-dioxo-6H-pyrimido[5,4-c][2,1]benzothiazine-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NS(=O)(=O)c1cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc1-2 |
| InChI | InChI=1S/C23H24N6O4S/c1-28-9-11-29(12-10-28)17-6-4-16(5-7-17)25-23-24-14-20-21(26-23)18-8-3-15(22(30)33-2)13-19(18)27-34(20,31)32/h3-8,13-14,27H,9-12H2,1-2H3,(H,24,25,26) |
| InChIKey | AYMULHQFZZONPL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|