C24H26N8O3 — CID 169089903
methyl 1-methyl-2-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-(1,3-oxazol-5-yl)pyrimidin-4-yl]imidazole-4-carboxylate (PubChem CID 169089903) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is methyl 1-methyl-2-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-(1,3-oxazol-5-yl)pyrimidin-4-yl]imidazole-4-carboxylate.
| Compound Name | methyl 1-methyl-2-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-(1,3-oxazol-5-yl)pyrimidin-4-yl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 169089903 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | methyl 1-methyl-2-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-(1,3-oxazol-5-yl)pyrimidin-4-yl]imidazole-4-carboxylate |
| SMILES | COC(=O)c1cn(C)c(-c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2-c2cnco2)n1 |
| InChI | InChI=1S/C24H26N8O3/c1-30-8-10-32(11-9-30)17-6-4-16(5-7-17)27-24-26-12-18(20-13-25-15-35-20)21(29-24)22-28-19(14-31(22)2)23(33)34-3/h4-7,12-15H,8-11H2,1-3H3,(H,26,27,29) |
| InChIKey | CNPWXESYEUGHCN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|