C22H24N6S — CID 90146060
6-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimido[5,4-c][2,1]benzothiazin-2-amine (PubChem CID 90146060) has the molecular formula C22H24N6S and a molecular weight of 404.54 g/mol. Its IUPAC name is 6-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimido[5,4-c][2,1]benzothiazin-2-amine.
| Compound Name | 6-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimido[5,4-c][2,1]benzothiazin-2-amine |
|---|---|
| PubChem CID | 90146060 |
| Molecular Formula | C22H24N6S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 6-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimido[5,4-c][2,1]benzothiazin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)-c3ccccc3N(C)S4)cc2)CC1 |
| InChI | InChI=1S/C22H24N6S/c1-26-11-13-28(14-12-26)17-9-7-16(8-10-17)24-22-23-15-20-21(25-22)18-5-3-4-6-19(18)27(2)29-20/h3-10,15H,11-14H2,1-2H3,(H,23,24,25) |
| InChIKey | SZSCQRZEEYJZJS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|