C27H27N7O2 — CID 169089919
4-(7-amino-1-benzofuran-2-yl)-N-[4-(4-amino-4-methylpiperidin-1-yl)phenyl]-5-(1,3-oxazol-5-yl)pyrimidin-2-amine (PubChem CID 169089919) has the molecular formula C27H27N7O2 and a molecular weight of 481.56 g/mol. Its IUPAC name is 4-(7-amino-1-benzofuran-2-yl)-N-[4-(4-amino-4-methylpiperidin-1-yl)phenyl]-5-(1,3-oxazol-5-yl)pyrimidin-2-amine.
| Compound Name | 4-(7-amino-1-benzofuran-2-yl)-N-[4-(4-amino-4-methylpiperidin-1-yl)phenyl]-5-(1,3-oxazol-5-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 169089919 |
| Molecular Formula | C27H27N7O2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 4-(7-amino-1-benzofuran-2-yl)-N-[4-(4-amino-4-methylpiperidin-1-yl)phenyl]-5-(1,3-oxazol-5-yl)pyrimidin-2-amine |
| SMILES | CC1(N)CCN(c2ccc(Nc3ncc(-c4cnco4)c(-c4cc5cccc(N)c5o4)n3)cc2)CC1 |
| InChI | InChI=1S/C27H27N7O2/c1-27(29)9-11-34(12-10-27)19-7-5-18(6-8-19)32-26-31-14-20(23-15-30-16-35-23)24(33-26)22-13-17-3-2-4-21(28)25(17)36-22/h2-8,13-16H,9-12,28-29H2,1H3,(H,31,32,33) |
| InChIKey | UHPSVFJOIYTWJO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 132.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|