C34H39N7O3S — CID 71207901
N-cyclopropyl-4-[5,5-dihydroxy-2-[4-(4-methylpiperazin-1-yl)anilino]-6-propylpyrimido[5,4-c][2,1]benzothiazin-8-yl]benzamide (PubChem CID 71207901) has the molecular formula C34H39N7O3S and a molecular weight of 625.80 g/mol. Its IUPAC name is N-cyclopropyl-4-[5,5-dihydroxy-2-[4-(4-methylpiperazin-1-yl)anilino]-6-propylpyrimido[5,4-c][2,1]benzothiazin-8-yl]benzamide.
| Compound Name | N-cyclopropyl-4-[5,5-dihydroxy-2-[4-(4-methylpiperazin-1-yl)anilino]-6-propylpyrimido[5,4-c][2,1]benzothiazin-8-yl]benzamide |
|---|---|
| PubChem CID | 71207901 |
| Molecular Formula | C34H39N7O3S |
| Molecular Weight | 625.80 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | N-cyclopropyl-4-[5,5-dihydroxy-2-[4-(4-methylpiperazin-1-yl)anilino]-6-propylpyrimido[5,4-c][2,1]benzothiazin-8-yl]benzamide |
| SMILES | CCCN1c2cc(-c3ccc(C(=O)NC4CC4)cc3)ccc2-c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2S1(O)O |
| InChI | InChI=1S/C34H39N7O3S/c1-3-16-41-30-21-25(23-4-6-24(7-5-23)33(42)36-26-9-10-26)8-15-29(30)32-31(45(41,43)44)22-35-34(38-32)37-27-11-13-28(14-12-27)40-19-17-39(2)18-20-40/h4-8,11-15,21-22,26,43-44H,3,9-10,16-20H2,1-2H3,(H,36,42)(H,35,37,38) |
| InChIKey | AOVCLLDXOFRXAN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.80 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|