C27H29BrN6O3S — CID 67997324
6-bromo-8-[ethylsulfonyl(phenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 67997324) has the molecular formula C27H29BrN6O3S and a molecular weight of 597.54 g/mol. Its IUPAC name is 6-bromo-8-[ethylsulfonyl(phenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-bromo-8-[ethylsulfonyl(phenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 67997324 |
| Molecular Formula | C27H29BrN6O3S |
| Molecular Weight | 597.54 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | 6-bromo-8-[ethylsulfonyl(phenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCS(=O)(=O)C(c1ccccc1)n1c(=O)c(Br)cc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C27H29BrN6O3S/c1-3-38(36,37)26(19-7-5-4-6-8-19)34-24-20(17-23(28)25(34)35)18-29-27(31-24)30-21-9-11-22(12-10-21)33-15-13-32(2)14-16-33/h4-12,17-18,26H,3,13-16H2,1-2H3,(H,29,30,31) |
| InChIKey | UYYPBPJLRJJZAL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|