C10H12N5O5 — CID 136701926
CID 136701926 (PubChem CID 136701926) has the molecular formula C10H12N5O5 and a molecular weight of 282.24 g/mol.
| Compound Name | CID 136701926 |
|---|---|
| PubChem CID | 136701926 |
| Molecular Formula | C10H12N5O5 |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | — |
| SMILES | Nc1nc2c(ncn2[C]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6-/m1/s1 |
| InChIKey | LDIDZBKRWAKBLO-UYFOZJQFSA-N |
| XLogP | -2.85 |
| TPSA | 159.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |