C17H13FN6O5S2 — CID 135491173
3-[[3-(2-amino-6-oxo-1H-purin-9-yl)phenyl]sulfamoyl]benzenesulfonyl fluoride (PubChem CID 135491173) has the molecular formula C17H13FN6O5S2 and a molecular weight of 464.46 g/mol. Its IUPAC name is 3-[[3-(2-amino-6-oxo-1H-purin-9-yl)phenyl]sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 3-[[3-(2-amino-6-oxo-1H-purin-9-yl)phenyl]sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 135491173 |
| Molecular Formula | C17H13FN6O5S2 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 3-[[3-(2-amino-6-oxo-1H-purin-9-yl)phenyl]sulfamoyl]benzenesulfonyl fluoride |
| SMILES | Nc1nc2c(ncn2-c2cccc(NS(=O)(=O)c3cccc(S(=O)(=O)F)c3)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H13FN6O5S2/c18-30(26,27)12-5-2-6-13(8-12)31(28,29)23-10-3-1-4-11(7-10)24-9-20-14-15(24)21-17(19)22-16(14)25/h1-9,23H,(H3,19,21,22,25) |
| InChIKey | LVPWLIJBEDSWBB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 169.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |