C11H9FN2O5S2 — CID 126815493
3-[(2-oxo-1H-pyridin-3-yl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 126815493) has the molecular formula C11H9FN2O5S2 and a molecular weight of 332.33 g/mol. Its IUPAC name is 3-[(2-oxo-1H-pyridin-3-yl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 3-[(2-oxo-1H-pyridin-3-yl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 126815493 |
| Molecular Formula | C11H9FN2O5S2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 3-[(2-oxo-1H-pyridin-3-yl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | O=c1[nH]cccc1NS(=O)(=O)c1cccc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C11H9FN2O5S2/c12-20(16,17)8-3-1-4-9(7-8)21(18,19)14-10-5-2-6-13-11(10)15/h1-7,14H,(H,13,15) |
| InChIKey | QZGVHKMTGOQACL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |