C12H16FNO4S2 — CID 114958356
3-[(1-methylcyclopentyl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 114958356) has the molecular formula C12H16FNO4S2 and a molecular weight of 321.39 g/mol. Its IUPAC name is 3-[(1-methylcyclopentyl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 3-[(1-methylcyclopentyl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114958356 |
| Molecular Formula | C12H16FNO4S2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 3-[(1-methylcyclopentyl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CC1(NS(=O)(=O)c2cccc(S(=O)(=O)F)c2)CCCC1 |
| InChI | InChI=1S/C12H16FNO4S2/c1-12(7-2-3-8-12)14-20(17,18)11-6-4-5-10(9-11)19(13,15)16/h4-6,9,14H,2-3,7-8H2,1H3 |
| InChIKey | RDPKKDBBFTXIQM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |