C15H22FNO4S2 — CID 166407096
3-[(1,4-dimethylcyclohexyl)methylsulfamoyl]benzenesulfonyl fluoride (PubChem CID 166407096) has the molecular formula C15H22FNO4S2 and a molecular weight of 363.48 g/mol. Its IUPAC name is 3-[(1,4-dimethylcyclohexyl)methylsulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 3-[(1,4-dimethylcyclohexyl)methylsulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 166407096 |
| Molecular Formula | C15H22FNO4S2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 3-[(1,4-dimethylcyclohexyl)methylsulfamoyl]benzenesulfonyl fluoride |
| SMILES | CC1CCC(C)(CNS(=O)(=O)c2cccc(S(=O)(=O)F)c2)CC1 |
| InChI | InChI=1S/C15H22FNO4S2/c1-12-6-8-15(2,9-7-12)11-17-23(20,21)14-5-3-4-13(10-14)22(16,18)19/h3-5,10,12,17H,6-9,11H2,1-2H3 |
| InChIKey | LXOMSHCJVJIZCP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |