C12H17FN2O4S2 — CID 114958196
3-(2-pyrrolidin-1-ylethylsulfamoyl)benzenesulfonyl fluoride (PubChem CID 114958196) has the molecular formula C12H17FN2O4S2 and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-(2-pyrrolidin-1-ylethylsulfamoyl)benzenesulfonyl fluoride.
| Compound Name | 3-(2-pyrrolidin-1-ylethylsulfamoyl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114958196 |
| Molecular Formula | C12H17FN2O4S2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 3-(2-pyrrolidin-1-ylethylsulfamoyl)benzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1cccc(S(=O)(=O)NCCN2CCCC2)c1 |
| InChI | InChI=1S/C12H17FN2O4S2/c13-20(16,17)11-4-3-5-12(10-11)21(18,19)14-6-9-15-7-1-2-8-15/h3-5,10,14H,1-2,6-9H2 |
| InChIKey | NIXNBOMSFVGOFC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |