C12H17NO3S — CID 113486170
3-(hydroxymethyl)-N-(1-methylcyclobutyl)benzenesulfonamide (PubChem CID 113486170) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-(hydroxymethyl)-N-(1-methylcyclobutyl)benzenesulfonamide.
| Compound Name | 3-(hydroxymethyl)-N-(1-methylcyclobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113486170 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-(hydroxymethyl)-N-(1-methylcyclobutyl)benzenesulfonamide |
| SMILES | CC1(NS(=O)(=O)c2cccc(CO)c2)CCC1 |
| InChI | InChI=1S/C12H17NO3S/c1-12(6-3-7-12)13-17(15,16)11-5-2-4-10(8-11)9-14/h2,4-5,8,13-14H,3,6-7,9H2,1H3 |
| InChIKey | MCDBQNBRQLNEGG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |