C11H14ClNO4S2 — CID 113485497
4-[(1-methylcyclobutyl)sulfamoyl]benzenesulfonyl chloride (PubChem CID 113485497) has the molecular formula C11H14ClNO4S2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 4-[(1-methylcyclobutyl)sulfamoyl]benzenesulfonyl chloride.
| Compound Name | 4-[(1-methylcyclobutyl)sulfamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 113485497 |
| Molecular Formula | C11H14ClNO4S2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 4-[(1-methylcyclobutyl)sulfamoyl]benzenesulfonyl chloride |
| SMILES | CC1(NS(=O)(=O)c2ccc(S(=O)(=O)Cl)cc2)CCC1 |
| InChI | InChI=1S/C11H14ClNO4S2/c1-11(7-2-8-11)13-19(16,17)10-5-3-9(4-6-10)18(12,14)15/h3-6,13H,2,7-8H2,1H3 |
| InChIKey | IMVMJWUGVBFOSF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |