C13H18FNO4S2 — CID 114958260
4-[(1-methylcyclohexyl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 114958260) has the molecular formula C13H18FNO4S2 and a molecular weight of 335.42 g/mol. Its IUPAC name is 4-[(1-methylcyclohexyl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[(1-methylcyclohexyl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114958260 |
| Molecular Formula | C13H18FNO4S2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 4-[(1-methylcyclohexyl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CC1(NS(=O)(=O)c2ccc(S(=O)(=O)F)cc2)CCCCC1 |
| InChI | InChI=1S/C13H18FNO4S2/c1-13(9-3-2-4-10-13)15-21(18,19)12-7-5-11(6-8-12)20(14,16)17/h5-8,15H,2-4,9-10H2,1H3 |
| InChIKey | FLMDNKKZWIEXJD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |