C14H13N3O4S — CID 110727217
1-methyl-2-oxo-N-(2-oxo-1H-pyridin-3-yl)-3H-indole-5-sulfonamide (PubChem CID 110727217) has the molecular formula C14H13N3O4S and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-(2-oxo-1H-pyridin-3-yl)-3H-indole-5-sulfonamide.
| Compound Name | 1-methyl-2-oxo-N-(2-oxo-1H-pyridin-3-yl)-3H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 110727217 |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-methyl-2-oxo-N-(2-oxo-1H-pyridin-3-yl)-3H-indole-5-sulfonamide |
| SMILES | CN1C(=O)Cc2cc(S(=O)(=O)Nc3ccc[nH]c3=O)ccc21 |
| InChI | InChI=1S/C14H13N3O4S/c1-17-12-5-4-10(7-9(12)8-13(17)18)22(20,21)16-11-3-2-6-15-14(11)19/h2-7,16H,8H2,1H3,(H,15,19) |
| InChIKey | LNFOEQYYCNKNLL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |