C22H17N3O3S2 — CID 24602664
N-[2-(1,3-benzothiazol-2-yl)phenyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide (PubChem CID 24602664) has the molecular formula C22H17N3O3S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)phenyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 24602664 |
| Molecular Formula | C22H17N3O3S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide |
| SMILES | CN1C(=O)Cc2cc(S(=O)(=O)Nc3ccccc3-c3nc4ccccc4s3)ccc21 |
| InChI | InChI=1S/C22H17N3O3S2/c1-25-19-11-10-15(12-14(19)13-21(25)26)30(27,28)24-17-7-3-2-6-16(17)22-23-18-8-4-5-9-20(18)29-22/h2-12,24H,13H2,1H3 |
| InChIKey | PVDRMCCQJICJSW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |