C19H19N3O3S2 — CID 91938372
N-(1,3-benzothiazol-2-yl)-1,4,4-trimethyl-2-oxo-3H-quinoline-6-sulfonamide (PubChem CID 91938372) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-1,4,4-trimethyl-2-oxo-3H-quinoline-6-sulfonamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-1,4,4-trimethyl-2-oxo-3H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 91938372 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-1,4,4-trimethyl-2-oxo-3H-quinoline-6-sulfonamide |
| SMILES | CN1C(=O)CC(C)(C)c2cc(S(=O)(=O)Nc3nc4ccccc4s3)ccc21 |
| InChI | InChI=1S/C19H19N3O3S2/c1-19(2)11-17(23)22(3)15-9-8-12(10-13(15)19)27(24,25)21-18-20-14-6-4-5-7-16(14)26-18/h4-10H,11H2,1-3H3,(H,20,21) |
| InChIKey | WBUBQTYBTJLMRH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |