C17H24N2O3S — CID 91938381
1,4,4-trimethyl-6-piperidin-1-ylsulfonyl-3H-quinolin-2-one (PubChem CID 91938381) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 1,4,4-trimethyl-6-piperidin-1-ylsulfonyl-3H-quinolin-2-one.
| Compound Name | 1,4,4-trimethyl-6-piperidin-1-ylsulfonyl-3H-quinolin-2-one |
|---|---|
| PubChem CID | 91938381 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1,4,4-trimethyl-6-piperidin-1-ylsulfonyl-3H-quinolin-2-one |
| SMILES | CN1C(=O)CC(C)(C)c2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C17H24N2O3S/c1-17(2)12-16(20)18(3)15-8-7-13(11-14(15)17)23(21,22)19-9-5-4-6-10-19/h7-8,11H,4-6,9-10,12H2,1-3H3 |
| InChIKey | VVHZPVRMRCMKCD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |