C14H20N2O3S — CID 141196357
4-methyl-7-piperidin-1-ylsulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 141196357) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 4-methyl-7-piperidin-1-ylsulfonyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-methyl-7-piperidin-1-ylsulfonyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 141196357 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-methyl-7-piperidin-1-ylsulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CN1CCOc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C14H20N2O3S/c1-15-9-10-19-14-11-12(5-6-13(14)15)20(17,18)16-7-3-2-4-8-16/h5-6,11H,2-4,7-10H2,1H3 |
| InChIKey | SPUGYCDWZZWCKK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |