C15H13ClN2O2S2 — CID 19683407
N-(1,3-benzothiazol-2-yl)-4-chloro-2,5-dimethylbenzenesulfonamide (PubChem CID 19683407) has the molecular formula C15H13ClN2O2S2 and a molecular weight of 352.87 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-chloro-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-chloro-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 19683407 |
| Molecular Formula | C15H13ClN2O2S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-chloro-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2nc3ccccc3s2)c(C)cc1Cl |
| InChI | InChI=1S/C15H13ClN2O2S2/c1-9-8-14(10(2)7-11(9)16)22(19,20)18-15-17-12-5-3-4-6-13(12)21-15/h3-8H,1-2H3,(H,17,18) |
| InChIKey | QUKYAFMEIGYXQY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |