C10H6ClN3O2S3 — CID 43455882
N-(1,3-benzothiazol-2-yl)-2-chloro-1,3-thiazole-5-sulfonamide (PubChem CID 43455882) has the molecular formula C10H6ClN3O2S3 and a molecular weight of 331.83 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-chloro-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-chloro-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43455882 |
| Molecular Formula | C10H6ClN3O2S3 |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 330.93 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-chloro-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2s1)c1cnc(Cl)s1 |
| InChI | InChI=1S/C10H6ClN3O2S3/c11-9-12-5-8(18-9)19(15,16)14-10-13-6-3-1-2-4-7(6)17-10/h1-5H,(H,13,14) |
| InChIKey | ATOGVDHQKONZKZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |