C14H11N3O5S2 — CID 2883984
N-(1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzenesulfonamide (PubChem CID 2883984) has the molecular formula C14H11N3O5S2 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzenesulfonamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2883984 |
| Molecular Formula | C14H11N3O5S2 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2nc3ccccc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11N3O5S2/c1-22-12-7-6-9(8-11(12)17(18)19)24(20,21)16-14-15-10-4-2-3-5-13(10)23-14/h2-8H,1H3,(H,15,16) |
| InChIKey | OMKLMZWHGOYMLY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|