C20H23ClN4O3S — CID 112807801
N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide (PubChem CID 112807801) has the molecular formula C20H23ClN4O3S and a molecular weight of 434.95 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 112807801 |
| Molecular Formula | C20H23ClN4O3S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-1-methyl-2-oxo-3H-indole-5-sulfonamide |
| SMILES | CN1CCN(c2ccc(Cl)cc2NS(=O)(=O)c2ccc3c(c2)CC(=O)N3C)CC1 |
| InChI | InChI=1S/C20H23ClN4O3S/c1-23-7-9-25(10-8-23)19-5-3-15(21)13-17(19)22-29(27,28)16-4-6-18-14(11-16)12-20(26)24(18)2/h3-6,11,13,22H,7-10,12H2,1-2H3 |
| InChIKey | DONKMNZPJGMFSR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |