C10H10N2O3S2 — CID 110727191
5-methyl-N-(2-oxo-1H-pyridin-3-yl)thiophene-2-sulfonamide (PubChem CID 110727191) has the molecular formula C10H10N2O3S2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 5-methyl-N-(2-oxo-1H-pyridin-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-(2-oxo-1H-pyridin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110727191 |
| Molecular Formula | C10H10N2O3S2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 5-methyl-N-(2-oxo-1H-pyridin-3-yl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc[nH]c2=O)s1 |
| InChI | InChI=1S/C10H10N2O3S2/c1-7-4-5-9(16-7)17(14,15)12-8-3-2-6-11-10(8)13/h2-6,12H,1H3,(H,11,13) |
| InChIKey | QVMKNLUZNFSOTP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |