C16H19N3O4S2 — CID 52908764
(3R)-1-(5-methylthiophen-2-yl)sulfonyl-N-(2-oxo-1H-pyridin-3-yl)piperidine-3-carboxamide (PubChem CID 52908764) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is (3R)-1-(5-methylthiophen-2-yl)sulfonyl-N-(2-oxo-1H-pyridin-3-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(5-methylthiophen-2-yl)sulfonyl-N-(2-oxo-1H-pyridin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 52908764 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (3R)-1-(5-methylthiophen-2-yl)sulfonyl-N-(2-oxo-1H-pyridin-3-yl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@@H](C(=O)Nc3ccc[nH]c3=O)C2)s1 |
| InChI | InChI=1S/C16H19N3O4S2/c1-11-6-7-14(24-11)25(22,23)19-9-3-4-12(10-19)15(20)18-13-5-2-8-17-16(13)21/h2,5-8,12H,3-4,9-10H2,1H3,(H,17,21)(H,18,20)/t12-/m1/s1 |
| InChIKey | MKIYHDGNPAWGGD-GFCCVEGCSA-N |
| XLogP | 1.78 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |