C17H15FN2O7S3 — CID 57071589
3-[[5-hydroxy-6-(methylsulfamoyl)naphthalen-1-yl]sulfamoyl]benzenesulfonyl fluoride (PubChem CID 57071589) has the molecular formula C17H15FN2O7S3 and a molecular weight of 474.51 g/mol. Its IUPAC name is 3-[[5-hydroxy-6-(methylsulfamoyl)naphthalen-1-yl]sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 3-[[5-hydroxy-6-(methylsulfamoyl)naphthalen-1-yl]sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 57071589 |
| Molecular Formula | C17H15FN2O7S3 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | 3-[[5-hydroxy-6-(methylsulfamoyl)naphthalen-1-yl]sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CNS(=O)(=O)c1ccc2c(NS(=O)(=O)c3cccc(S(=O)(=O)F)c3)cccc2c1O |
| InChI | InChI=1S/C17H15FN2O7S3/c1-19-30(26,27)16-9-8-13-14(17(16)21)6-3-7-15(13)20-29(24,25)12-5-2-4-11(10-12)28(18,22)23/h2-10,19-21H,1H3 |
| InChIKey | IUOQHNKAQFOMFW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 146.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |