C19H18N2O7S2 — CID 19987122
3-[[5-hydroxy-6-(propanoylamino)naphthalen-1-yl]sulfamoyl]benzenesulfonic acid (PubChem CID 19987122) has the molecular formula C19H18N2O7S2 and a molecular weight of 450.49 g/mol. Its IUPAC name is 3-[[5-hydroxy-6-(propanoylamino)naphthalen-1-yl]sulfamoyl]benzenesulfonic acid.
| Compound Name | 3-[[5-hydroxy-6-(propanoylamino)naphthalen-1-yl]sulfamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 19987122 |
| Molecular Formula | C19H18N2O7S2 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 3-[[5-hydroxy-6-(propanoylamino)naphthalen-1-yl]sulfamoyl]benzenesulfonic acid |
| SMILES | CCC(=O)Nc1ccc2c(NS(=O)(=O)c3cccc(S(=O)(=O)O)c3)cccc2c1O |
| InChI | InChI=1S/C19H18N2O7S2/c1-2-18(22)20-17-10-9-14-15(19(17)23)7-4-8-16(14)21-29(24,25)12-5-3-6-13(11-12)30(26,27)28/h3-11,21,23H,2H2,1H3,(H,20,22)(H,26,27,28) |
| InChIKey | WPVJRYPTCZHUMY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|