C16H14N2O4S2 — CID 30285558
3-N-naphthalen-1-ylbenzene-1,3-disulfonamide (PubChem CID 30285558) has the molecular formula C16H14N2O4S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-N-naphthalen-1-ylbenzene-1,3-disulfonamide.
| Compound Name | 3-N-naphthalen-1-ylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 30285558 |
| Molecular Formula | C16H14N2O4S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 3-N-naphthalen-1-ylbenzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)Nc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C16H14N2O4S2/c17-23(19,20)13-7-4-8-14(11-13)24(21,22)18-16-10-3-6-12-5-1-2-9-15(12)16/h1-11,18H,(H2,17,19,20) |
| InChIKey | RIFRKPLNIFKSGF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |