C18H15ClN2O5S2 — CID 25325682
3-N-[2-(2-chlorophenoxy)phenyl]benzene-1,3-disulfonamide (PubChem CID 25325682) has the molecular formula C18H15ClN2O5S2 and a molecular weight of 438.91 g/mol. Its IUPAC name is 3-N-[2-(2-chlorophenoxy)phenyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[2-(2-chlorophenoxy)phenyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 25325682 |
| Molecular Formula | C18H15ClN2O5S2 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 3-N-[2-(2-chlorophenoxy)phenyl]benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)Nc2ccccc2Oc2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H15ClN2O5S2/c19-15-8-1-3-10-17(15)26-18-11-4-2-9-16(18)21-28(24,25)14-7-5-6-13(12-14)27(20,22)23/h1-12,21H,(H2,20,22,23) |
| InChIKey | BIBAXYRIRAVOQJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |