C13H8Cl2F3NO3S — CID 3460603
3,4-dichloro-N-[2-(trifluoromethoxy)phenyl]benzenesulfonamide (PubChem CID 3460603) has the molecular formula C13H8Cl2F3NO3S and a molecular weight of 386.18 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(trifluoromethoxy)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[2-(trifluoromethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3460603 |
| Molecular Formula | C13H8Cl2F3NO3S |
| Molecular Weight | 386.18 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 3,4-dichloro-N-[2-(trifluoromethoxy)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1OC(F)(F)F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2F3NO3S/c14-9-6-5-8(7-10(9)15)23(20,21)19-11-3-1-2-4-12(11)22-13(16,17)18/h1-7,19H |
| InChIKey | GWYXOHYYTKRDAE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.18 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |