C12H8Cl2FNO3S — CID 63677626
3,4-dichloro-N-(4-fluoro-2-hydroxyphenyl)benzenesulfonamide (PubChem CID 63677626) has the molecular formula C12H8Cl2FNO3S and a molecular weight of 336.17 g/mol. Its IUPAC name is 3,4-dichloro-N-(4-fluoro-2-hydroxyphenyl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(4-fluoro-2-hydroxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63677626 |
| Molecular Formula | C12H8Cl2FNO3S |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 3,4-dichloro-N-(4-fluoro-2-hydroxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)cc1O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2FNO3S/c13-9-3-2-8(6-10(9)14)20(18,19)16-11-4-1-7(15)5-12(11)17/h1-6,16-17H |
| InChIKey | UMTUZLLYXKGRKL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|