C15H16N2O6S2 — CID 18283717
methyl 2-methyl-6-[(3-sulfamoylphenyl)sulfonylamino]benzoate (PubChem CID 18283717) has the molecular formula C15H16N2O6S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is methyl 2-methyl-6-[(3-sulfamoylphenyl)sulfonylamino]benzoate.
| Compound Name | methyl 2-methyl-6-[(3-sulfamoylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 18283717 |
| Molecular Formula | C15H16N2O6S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | methyl 2-methyl-6-[(3-sulfamoylphenyl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1c(C)cccc1NS(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H16N2O6S2/c1-10-5-3-8-13(14(10)15(18)23-2)17-25(21,22)12-7-4-6-11(9-12)24(16,19)20/h3-9,17H,1-2H3,(H2,16,19,20) |
| InChIKey | FJWXWDXYTJHQFY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |