C14H13NNaO6S — CID 173174462
CID 173174462 (PubChem CID 173174462) has the molecular formula C14H13NNaO6S and a molecular weight of 346.32 g/mol.
| Compound Name | CID 173174462 |
|---|---|
| PubChem CID | 173174462 |
| Molecular Formula | C14H13NNaO6S |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | — |
| SMILES | CC(=O)CC(=O)Nc1cc(S(=O)(=O)O)c(O)c2ccccc12.[Na] |
| InChI | InChI=1S/C14H13NO6S.Na/c1-8(16)6-13(17)15-11-7-12(22(19,20)21)14(18)10-5-3-2-4-9(10)11;/h2-5,7,18H,6H2,1H3,(H,15,17)(H,19,20,21); |
| InChIKey | HYIRVLNXDVAEHQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|