C35H30N4O13S4 — CID 88674287
5-hydroxy-8-[[4-[[4-[(4-hydroxy-7-sulfonaphthalen-1-yl)sulfamoyl]-2-methylphenyl]carbamoylamino]-3-methylphenyl]sulfonylamino]naphthalene-2-sulfonic acid (PubChem CID 88674287) has the molecular formula C35H30N4O13S4 and a molecular weight of 842.91 g/mol. Its IUPAC name is 5-hydroxy-8-[[4-[[4-[(4-hydroxy-7-sulfonaphthalen-1-yl)sulfamoyl]-2-methylphenyl]carbamoylamino]-3-methylphenyl]sulfonylamino]naphthalene-2-sulfonic acid.
| Compound Name | 5-hydroxy-8-[[4-[[4-[(4-hydroxy-7-sulfonaphthalen-1-yl)sulfamoyl]-2-methylphenyl]carbamoylamino]-3-methylphenyl]sulfonylamino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 88674287 |
| Molecular Formula | C35H30N4O13S4 |
| Molecular Weight | 842.91 g/mol |
| Exact Mass | 842.07 |
| IUPAC Name | 5-hydroxy-8-[[4-[[4-[(4-hydroxy-7-sulfonaphthalen-1-yl)sulfamoyl]-2-methylphenyl]carbamoylamino]-3-methylphenyl]sulfonylamino]naphthalene-2-sulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(O)c3ccc(S(=O)(=O)O)cc23)ccc1NC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(O)c3ccc(S(=O)(=O)O)cc23)cc1C |
| InChI | InChI=1S/C35H30N4O13S4/c1-19-15-21(53(43,44)38-31-11-13-33(40)25-7-3-23(17-27(25)31)55(47,48)49)5-9-29(19)36-35(42)37-30-10-6-22(16-20(30)2)54(45,46)39-32-12-14-34(41)26-8-4-24(18-28(26)32)56(50,51)52/h3-18,38-41H,1-2H3,(H2,36,37,42)(H,47,48,49)(H,50,51,52) |
| InChIKey | BYQXQNAXDDXGHQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 282.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.91 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|