C14H13F3N2O5S2 — CID 54007952
4-[[4-amino-3-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbenzenesulfonic acid (PubChem CID 54007952) has the molecular formula C14H13F3N2O5S2 and a molecular weight of 410.40 g/mol. Its IUPAC name is 4-[[4-amino-3-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbenzenesulfonic acid.
| Compound Name | 4-[[4-amino-3-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 54007952 |
| Molecular Formula | C14H13F3N2O5S2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 4-[[4-amino-3-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)ccc1NS(=O)(=O)c1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F3N2O5S2/c1-8-6-10(26(22,23)24)3-5-13(8)19-25(20,21)9-2-4-12(18)11(7-9)14(15,16)17/h2-7,19H,18H2,1H3,(H,22,23,24) |
| InChIKey | KQFPNBBAOJVVNJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|