C14H13ClF3N5O2 — CID 136934341
2-amino-9-[[4-methoxy-3-(trifluoromethyl)phenyl]methyl]-1H-purin-6-one;hydrochloride (PubChem CID 136934341) has the molecular formula C14H13ClF3N5O2 and a molecular weight of 375.74 g/mol. Its IUPAC name is 2-amino-9-[[4-methoxy-3-(trifluoromethyl)phenyl]methyl]-1H-purin-6-one;hydrochloride.
| Compound Name | 2-amino-9-[[4-methoxy-3-(trifluoromethyl)phenyl]methyl]-1H-purin-6-one;hydrochloride |
|---|---|
| PubChem CID | 136934341 |
| Molecular Formula | C14H13ClF3N5O2 |
| Molecular Weight | 375.74 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-amino-9-[[4-methoxy-3-(trifluoromethyl)phenyl]methyl]-1H-purin-6-one;hydrochloride |
| SMILES | COc1ccc(Cn2cnc3c(=O)[nH]c(N)nc32)cc1C(F)(F)F.Cl |
| InChI | InChI=1S/C14H12F3N5O2.ClH/c1-24-9-3-2-7(4-8(9)14(15,16)17)5-22-6-19-10-11(22)20-13(18)21-12(10)23;/h2-4,6H,5H2,1H3,(H3,18,20,21,23);1H |
| InChIKey | KDOGANUEZQKQLE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.74 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |